Lundazi District, Eastern Province, Zambiai
| Regional Level Types | |
|---|---|
| Lundazi District | District |
| Eastern Province | Province |
| Zambia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Lundazi | 11,635 (2012) |
Mindat Locality ID:
31528
Long-form identifier:
mindat:1:2:31528:8
GUID (UUID V4):
bdb2a5cb-ae45-4318-8082-41062a2360f7
Other Languages:
French:
District de Lundazi, Province orientale, Zambie
Italian:
Distretto di Lundazi, Zambia orientale, Zambia
Simplified Chinese:
ιιζΏηΈ£, δΈζΉη, θ΅ζ―δΊ
Cebuano:
Lundazi District, Eastern Province
Dutch:
Lundazi District, Eastern, Zambia
Hill Mari:
ΠΡΠ½Π΄Π°Π·ΠΈ , ΠΡΠ²Π΅Π» ΠΏΡΠΎΠ²ΠΈΠ½ΡΠΈ
Japanese:
γ«γ³γγΈε°εΊ, ζ±ι¨ε· , γΆγ³γγ’
Lithuanian:
Lundazio apskritis, RytΕ³ provincija, Zambija
Minnan / Hokkien-Taiwanese:
Lundazi KoΔn
Polish:
Dystrykt Lundazi, Prowincja Wschodnia, Zambia
Lundazi District is a district of Zambia, located in Eastern Province. The capital lies at Lundazi. In 2018, Lundazi district was divided into 3 districts (Lundazi, Lumezi and Chasefu) by the Government of the Republic of Zambia to enable rural development.
Gem mining.
Numerous pegmatites containing gem-quality aquamarine, tourmaline, and spessartine occur in a large area west and southwest of Lundazi, and east of the Luangwa River.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities7 valid minerals.
Detailed Mineral List:
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Ilmenite Formula: Fe2+TiO3 |
| β Ilmenite var. Manganese-bearing Ilmenite Formula: (Fe,Mn)2+TiO3 |
| β 'K Feldspar' |
| β 'Limonite' |
| β Pyrope Formula: Mg3Al2(SiO4)3 |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Ilmenite var. Manganese-bearing Ilmenite | 4.CB.05 | (Fe,Mn)2+TiO3 |
| β | 4.CB.05 | Fe2+TiO3 | |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| β | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Foitite | 9.CK.05 | β»(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Pyrope | Mg3Al2(SiO4)3 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Na | Sodium | |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Pyrope | Mg3Al2(SiO4)3 |
| Al | Aluminium | |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Pyrope | Mg3Al2(SiO4)3 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Pyrope | Mg3Al2(SiO4)3 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Mn | Manganese | |
| Mn | β Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Fe | Iron | |
| Fe | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Lundazi_District |
|---|---|
| Wikidata ID: | Q3031426 |
| GeoNames ID: | 909296 |
Localities in this Region
- Eastern Province
- Lundazi District
Other Regions, Features and Areas that Intersect
African PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Lundazi District, Eastern Province, Zambia