Interstate 84 road cuts, Town of Southeast, Putnam County, New York, USAi
| Regional Level Types | |
|---|---|
| Interstate 84 road cuts | Group of Road Cuttings |
| Town of Southeast | Town |
| Putnam County | County |
| New York | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 24' 54'' North , 73° 37' 9'' West
Latitude & Longitude (decimal):
Type:
Group of Road Cuttings
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Brewster Hill | 2,089 (2017) | 1.6km |
| Brewster | 2,332 (2017) | 2.0km |
| Carmel | 4,800 (2017) | 5.3km |
| Carmel Hamlet | 6,817 (2017) | 5.5km |
| Peach Lake | 1,629 (2017) | 6.3km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Danbury Mineralogical Society | Danbury, Connecticut | 14km |
| Mid-Hudson Valley Gem and Mineral Society Inc. | Poughkeepsie, New York | 40km |
| Stamford Mineralogical Society | Stamford, Connecticut | 41km |
Mindat Locality ID:
23395
Long-form identifier:
mindat:1:2:23395:7
GUID (UUID V4):
e03e9001-acf9-4b4c-8908-4aaa605d564d
Road cuts into mostly Proterozoic metamorphic bedrock between US Route 202 and the northern boundary of Southeast. Coordinates put at approximate mid-point of this stretch of highway. Exact locations of specimens, collected by Ronald Januzzi, were not recorded. Much of the bedrock cut through is amphibolite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Habit: acicular Colour: dark green Description: Small crystals lining a cleft in metamorphic rock with meionite and epidote. References: |
| β Albite Formula: Na(AlSi3O8) |
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β Almandine Formula: Fe2+3Al2(SiO4)3 |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' |
| β Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β Diopside Formula: CaMgSi2O6 |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Colour: olive Description: small crystals in a cleft in calc-silicate rock with actinolite and meionite. References: |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Gypsum Formula: CaSO4 · 2H2O |
| β Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| β Hematite Formula: Fe2O3 |
| β 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β Ilmenite Formula: Fe2+TiO3 |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O |
| β 'Limonite' |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Marcasite Formula: FeS2 |
| βͺ Meionite Formula: Ca4Al6Si6O24CO3 Habit: Elongated prisms Colour: white Fluorescence: magenta under SW UV Description: Elongated crystals to 10 cm in a cleft in calc-silicate rock with actinolite and epidote. References: |
| β Microcline Formula: K(AlSi3O8) Habit: massive Colour: white References: |
| β Molybdenite Formula: MoS2 |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Opal Formula: SiO2 · nH2O |
| β Opal var. Opal-AN Formula: SiO2 · nH2O |
| β Pyrite Formula: FeS2 |
| β Pyrolusite Formula: Mn4+O2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 |
| β Rutile Formula: TiO2 |
| β Scheelite Formula: Ca(WO4) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| β | Pyrolusite | 4.DB.05 | Mn4+O2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| β | var. Selenite | 7.CD.40 | CaSO4 Β· 2H2O |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | β Gypsum var. Selenite | CaSO4 · 2H2O |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Diopside | CaMgSi2O6 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hematite | Fe2O3 |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Meionite | Ca4Al6Si6O24CO3 |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Pyrolusite | Mn4+O2 |
| O | β Quartz | SiO2 |
| O | β Rutile | TiO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Zircon | Zr(SiO4) |
| O | β Gypsum var. Selenite | CaSO4 · 2H2O |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Meionite | Ca4Al6Si6O24CO3 |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Meionite | Ca4Al6Si6O24CO3 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Meionite | Ca4Al6Si6O24CO3 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | β Chalcopyrite | CuFeS2 |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Marcasite | FeS2 |
| S | β Meionite | Ca4Al6Si6O24CO3 |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Gypsum var. Selenite | CaSO4 · 2H2O |
| Cl | Chlorine | |
| Cl | β Meionite | Ca4Al6Si6O24CO3 |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Meionite | Ca4Al6Si6O24CO3 |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | β Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Rutile | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | β Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Marcasite | FeS2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Laurentides DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Interstate 84 road cuts, Town of Southeast, Putnam County, New York, USA