Smith No. 1 Mine, Raymond, Rockingham County, New Hampshire, USAi
| Regional Level Types | |
|---|---|
| Smith No. 1 Mine | Mine |
| Raymond | Town |
| Rockingham County | County |
| New Hampshire | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
43° North , 71° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~7km
Type:
KΓΆppen climate type:
Mindat Locality ID:
15864
Long-form identifier:
mindat:1:2:15864:7
GUID (UUID V4):
3e913fe7-6d20-4f46-89e8-ef8a0845b9bd
Other/historical names associated with this locality:
Pegmatites Nos. 9 & 10
A feldspar mine in pegmatite, prospected by Cyrus G. Smith in 1942, and worked by the Whitehall Company from 1946 to 1947.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Almandine Formula: Fe2+3Al2(SiO4)3 |
| β Arsenopyrite Formula: FeAsS |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 |
| β Beryl Formula: Be3Al2(Si6O18) |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorite Formula: CaF2 |
| β Goethite Formula: Ξ±-Fe3+O(OH) |
| β 'Lepidolite' |
| β Microcline Formula: K(AlSi3O8) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Formula: (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 Description: No new data. Entry based on previous report that has been discredited. |
| β Pyrite Formula: FeS2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Siderite Formula: FeCO3 |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Spodumene Formula: LiAlSi2O6 |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β Triphylite Formula: LiFe2+PO4 References: |
| β Uraninite Formula: UO2 |
| β Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| β | Palermoite ? | 8.BH.25 | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Lepidolite' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Li | Lithium | |
| Li | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Li | β Spodumene | LiAlSi2O6 |
| Li | β Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Siderite | FeCO3 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Spodumene | LiAlSi2O6 |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Triphylite | LiFe2+PO4 |
| O | β Uraninite | UO2 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Spodumene | LiAlSi2O6 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Triphylite | LiFe2+PO4 |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderite | FeCO3 |
| Fe | β Triphylite | LiFe2+PO4 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| Sr | Strontium | |
| Sr | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Uraninite | UO2 |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
