Sopa, Diamantina, Minas Gerais, Brazili
Regional Level Types | |
---|---|
Sopa | - not defined - |
Diamantina | Municipality |
Minas Gerais | State |
Brazil | Country |
This page is currently not sponsored. Click here to sponsor this page.
Mindat Locality ID:
106220
Long-form identifier:
mindat:1:2:106220:8
GUID (UUID V4):
0047da60-d454-44f2-9117-43beb1938019
Small Village known for its diamond mines since the 17th century.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities19 valid minerals.
Detailed Mineral List:
β Anatase Formula: TiO2 |
β Andalusite Formula: Al2(SiO4)O |
β Chrysoberyl Formula: BeAl2O4 |
β Diamond Formula: C Localities: Reported from at least 6 localities in this region. |
β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
β Gold Formula: Au |
β Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
β Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 |
β Hematite Formula: Fe2O3 |
β Kyanite Formula: Al2(SiO4)O |
β Lazulite Formula: MgAl2(PO4)2(OH)2 |
β Magnetite Formula: Fe2+Fe3+2O4 |
β 'Monazite' Formula: REE(PO4) |
β Pyrite Formula: FeS2 |
β Quartz Formula: SiO2 |
β Quartz var. Rock Crystal Formula: SiO2 References: |
β Rutile Formula: TiO2 |
β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
β Senaite Formula: Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
β Xenotime-(Y) Formula: Y(PO4) |
β Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
β | Gold | 1.AA.05 | Au |
β | Diamond | 1.CB.10a | C |
Group 2 - Sulphides and Sulfosalts | |||
β | Pyrite | 2.EB.05a | FeS2 |
Group 4 - Oxides and Hydroxides | |||
β | Chrysoberyl | 4.BA.05 | BeAl2O4 |
β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
β | Hematite | 4.CB.05 | Fe2O3 |
β | Senaite | 4.CC.40 | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
β | Quartz var. Rock Crystal | 4.DA.05 | SiO2 |
β | 4.DA.05 | SiO2 | |
β | Rutile | 4.DB.05 | TiO2 |
β | Anatase | 4.DD.05 | TiO2 |
Group 8 - Phosphates, Arsenates and Vanadates | |||
β | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
β | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
β | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
β | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
Group 9 - Silicates | |||
β | Zircon | 9.AD.30 | Zr(SiO4) |
β | Andalusite | 9.AF.10 | Al2(SiO4)O |
β | Kyanite | 9.AF.15 | Al2(SiO4)O |
β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Unclassified | |||
β | 'Monazite' | - | REE(PO4) |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | β Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
H | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
H | β Lazulite | MgAl2(PO4)2(OH)2 |
H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Li | Lithium | |
Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Be | Beryllium | |
Be | β Chrysoberyl | BeAl2O4 |
B | Boron | |
B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
C | Carbon | |
C | β Diamond | C |
O | Oxygen | |
O | β Anatase | TiO2 |
O | β Andalusite | Al2(SiO4)O |
O | β Chrysoberyl | BeAl2O4 |
O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | β Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
O | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
O | β Hematite | Fe2O3 |
O | β Kyanite | Al2(SiO4)O |
O | β Lazulite | MgAl2(PO4)2(OH)2 |
O | β Magnetite | Fe2+Fe23+O4 |
O | β Monazite | REE(PO4) |
O | β Quartz | SiO2 |
O | β Rutile | TiO2 |
O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
O | β Xenotime-(Y) | Y(PO4) |
O | β Zircon | Zr(SiO4) |
O | β Quartz var. Rock Crystal | SiO2 |
Na | Sodium | |
Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | Magnesium | |
Mg | β Lazulite | MgAl2(PO4)2(OH)2 |
Al | Aluminium | |
Al | β Andalusite | Al2(SiO4)O |
Al | β Chrysoberyl | BeAl2O4 |
Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | β Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
Al | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
Al | β Kyanite | Al2(SiO4)O |
Al | β Lazulite | MgAl2(PO4)2(OH)2 |
Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | Silicon | |
Si | β Andalusite | Al2(SiO4)O |
Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | β Kyanite | Al2(SiO4)O |
Si | β Quartz | SiO2 |
Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | β Zircon | Zr(SiO4) |
Si | β Quartz var. Rock Crystal | SiO2 |
P | Phosphorus | |
P | β Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
P | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
P | β Lazulite | MgAl2(PO4)2(OH)2 |
P | β Monazite | REE(PO4) |
P | β Xenotime-(Y) | Y(PO4) |
S | Sulfur | |
S | β Pyrite | FeS2 |
Ti | Titanium | |
Ti | β Anatase | TiO2 |
Ti | β Rutile | TiO2 |
Ti | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
V | Vanadium | |
V | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Cr | Chromium | |
Cr | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Mn | Manganese | |
Mn | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Fe | Iron | |
Fe | β Hematite | Fe2O3 |
Fe | β Magnetite | Fe2+Fe23+O4 |
Fe | β Pyrite | FeS2 |
Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Zn | Zinc | |
Zn | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Sr | Strontium | |
Sr | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
Y | Yttrium | |
Y | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Y | β Xenotime-(Y) | Y(PO4) |
Zr | Zirconium | |
Zr | β Zircon | Zr(SiO4) |
Ba | Barium | |
Ba | β Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
Au | Gold | |
Au | β Gold | Au |
Pb | Lead | |
Pb | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
U | Uranium | |
U | β Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Minas Gerais
Other Regions, Features and Areas that Intersect
South America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
CaldeirΓ΅es claim, Sopa, Diamantina, Minas Gerais, Brazil