Abborrselet, Bräcke, Jämtland County, Swedeni
| Regional Level Types | |
|---|---|
| Abborrselet | Quarry |
| Bräcke | Municipality |
| Jämtland County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
62° 51' 28'' North , 15° 49' 55'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kälarne | 435 (2017) | 18.9km |
| Bräcke | 1,559 (2017) | 24.0km |
| Stugun | 599 (2017) | 36.2km |
| Ånge | 2,889 (2017) | 38.1km |
| Ljungaverk | 917 (2013) | 42.4km |
Mindat Locality ID:
10579
Long-form identifier:
mindat:1:2:10579:7
GUID (UUID V4):
a86e4df3-f29d-4adf-9bf0-2eb880a1d099
Quartz-feldspar quarry.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
18 valid minerals.
Detailed Mineral List:
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Euxenite-(Y) ? Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Description: no Ti-bearing REE-oxides has been identified by EPMA References: |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ 'Fluocerite' |
| ⓘ Fluocerite-(Ce) Formula: CeF3 References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Fluocerite-(Ce) | 3.AC.15 | CeF3 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Euxenite-(Y) ? | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Fluocerite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| F | Fluorine | |
| F | ⓘ Fluocerite-(Ce) | CeF3 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | Aluminium | |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| P | Phosphorus | |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Y | Yttrium | |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Fluocerite-(Ce) | CeF3 |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Abborrselet, Bräcke, Jämtland County, Sweden